C15H26O7Si — CID 175403302
2,3-dimethyl-6-(2-methylprop-2-enoyloxy)-4-trimethoxysilylhex-2-enoic acid (PubChem CID 175403302) has the molecular formula C15H26O7Si and a molecular weight of 346.45 g/mol. Its IUPAC name is 2,3-dimethyl-6-(2-methylprop-2-enoyloxy)-4-trimethoxysilylhex-2-enoic acid.
| Compound Name | 2,3-dimethyl-6-(2-methylprop-2-enoyloxy)-4-trimethoxysilylhex-2-enoic acid |
|---|---|
| PubChem CID | 175403302 |
| Molecular Formula | C15H26O7Si |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 2,3-dimethyl-6-(2-methylprop-2-enoyloxy)-4-trimethoxysilylhex-2-enoic acid |
| SMILES | C=C(C)C(=O)OCCC(C(C)=C(C)C(=O)O)[Si](OC)(OC)OC |
| InChI | InChI=1S/C15H26O7Si/c1-10(2)15(18)22-9-8-13(11(3)12(4)14(16)17)23(19-5,20-6)21-7/h13H,1,8-9H2,2-7H3,(H,16,17) |
| InChIKey | DRICWGNUWNUVGO-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|