C9H13NO3S — CID 175088450
(3-hydroxy-4-isothiocyanatobutyl) 2-methylprop-2-enoate (PubChem CID 175088450) has the molecular formula C9H13NO3S and a molecular weight of 215.27 g/mol. Its IUPAC name is (3-hydroxy-4-isothiocyanatobutyl) 2-methylprop-2-enoate.
| Compound Name | (3-hydroxy-4-isothiocyanatobutyl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 175088450 |
| Molecular Formula | C9H13NO3S |
| Molecular Weight | 215.27 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | (3-hydroxy-4-isothiocyanatobutyl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC(O)CN=C=S |
| InChI | InChI=1S/C9H13NO3S/c1-7(2)9(12)13-4-3-8(11)5-10-6-14/h8,11H,1,3-5H2,2H3 |
| InChIKey | SHSBSOXCHWVZFF-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.27 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|