C14H21NO5S — CID 88712916
butyl 2-sulfanylprop-2-enoate;2-isocyanatoethyl 2-methylprop-2-enoate (PubChem CID 88712916) has the molecular formula C14H21NO5S and a molecular weight of 315.39 g/mol. Its IUPAC name is butyl 2-sulfanylprop-2-enoate;2-isocyanatoethyl 2-methylprop-2-enoate.
| Compound Name | butyl 2-sulfanylprop-2-enoate;2-isocyanatoethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 88712916 |
| Molecular Formula | C14H21NO5S |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | butyl 2-sulfanylprop-2-enoate;2-isocyanatoethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCN=C=O.C=C(S)C(=O)OCCCC |
| InChI | InChI=1S/C7H9NO3.C7H12O2S/c1-6(2)7(10)11-4-3-8-5-9;1-3-4-5-9-7(8)6(2)10/h1,3-4H2,2H3;10H,2-5H2,1H3 |
| InChIKey | DFYLJRMXBDSZGW-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|