C22H31N3O9 — CID 139970123
tris(2-isocyanatoethyl) 1-methylnonane-1,4,9-tricarboxylate (PubChem CID 139970123) has the molecular formula C22H31N3O9 and a molecular weight of 481.50 g/mol. Its IUPAC name is tris(2-isocyanatoethyl) 1-methylnonane-1,4,9-tricarboxylate.
| Compound Name | tris(2-isocyanatoethyl) 1-methylnonane-1,4,9-tricarboxylate |
|---|---|
| PubChem CID | 139970123 |
| Molecular Formula | C22H31N3O9 |
| Molecular Weight | 481.50 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | tris(2-isocyanatoethyl) 1-methylnonane-1,4,9-tricarboxylate |
| SMILES | CC(CCC(CCCCCC(=O)OCCN=C=O)C(=O)OCCN=C=O)C(=O)OCCN=C=O |
| InChI | InChI=1S/C22H31N3O9/c1-18(21(30)33-13-10-24-16-27)7-8-19(22(31)34-14-11-25-17-28)5-3-2-4-6-20(29)32-12-9-23-15-26/h18-19H,2-14H2,1H3 |
| InChIKey | LOIIIOMNILLXLJ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 167.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.50 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|