About acetyl 4,9-diisocyanatononanoate
acetyl 4,9-diisocyanatononanoate (PubChem CID 174681384) has the molecular formula C13H18N2O5
and a molecular weight of 282.30 g/mol. Its IUPAC name is acetyl 4,9-diisocyanatononanoate.
Molecular Properties
| Compound Name | acetyl 4,9-diisocyanatononanoate |
| PubChem CID | 174681384 |
| Molecular Formula | C13H18N2O5 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | acetyl 4,9-diisocyanatononanoate |
| SMILES | CC(=O)OC(=O)CCC(CCCCCN=C=O)N=C=O |
| InChI | InChI=1S/C13H18N2O5/c1-11(18)20-13(19)7-6-12(15-10-17)5-3-2-4-8-14-9-16/h12H,2-8H2,1H3 |
| InChIKey | BQIBBYPYSDVDAQ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 102.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze acetyl 4,9-diisocyanatononanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetyl 4,9-diisocyanatononanoate?
The IUPAC name of acetyl 4,9-diisocyanatononanoate (CID 174681384) is acetyl 4,9-diisocyanatononanoate.
What is the SMILES notation for acetyl 4,9-diisocyanatononanoate?
The canonical SMILES for acetyl 4,9-diisocyanatononanoate is CC(=O)OC(=O)CCC(CCCCCN=C=O)N=C=O.
What is the InChIKey of acetyl 4,9-diisocyanatononanoate?
The InChIKey is BQIBBYPYSDVDAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O5/c1-11(18)20-13(19)7-6-12(15-10-17)5-3-2-4-8-14-9-16/h12H,2-8H2,1H3.
What are the key properties of acetyl 4,9-diisocyanatononanoate?
acetyl 4,9-diisocyanatononanoate has a molecular weight of 282.30 g/mol, XLogP of 1.46, 10 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for acetyl 4,9-diisocyanatononanoate is sourced from PubChem (CID 174681384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).