C10H10N4O4 — CID 152640510
1,1,4,6-tetraisocyanatohexane (PubChem CID 152640510) has the molecular formula C10H10N4O4 and a molecular weight of 250.21 g/mol. Its IUPAC name is 1,1,4,6-tetraisocyanatohexane.
| Compound Name | 1,1,4,6-tetraisocyanatohexane |
|---|---|
| PubChem CID | 152640510 |
| Molecular Formula | C10H10N4O4 |
| Molecular Weight | 250.21 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | 1,1,4,6-tetraisocyanatohexane |
| SMILES | O=C=NCCC(CCC(N=C=O)N=C=O)N=C=O |
| InChI | InChI=1S/C10H10N4O4/c15-5-11-4-3-9(12-6-16)1-2-10(13-7-17)14-8-18/h9-10H,1-4H2 |
| InChIKey | ZFLOAXJBTAIHPI-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 117.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.21 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|