About 5-isocyanatononane
5-isocyanatononane (PubChem CID 153403979) has the molecular formula C10H19NO
and a molecular weight of 169.27 g/mol. Its IUPAC name is 5-isocyanatononane.
Molecular Properties
| Compound Name | 5-isocyanatononane |
| PubChem CID | 153403979 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | 5-isocyanatononane |
| SMILES | CCCCC(CCCC)N=C=O |
| InChI | InChI=1S/C10H19NO/c1-3-5-7-10(11-9-12)8-6-4-2/h10H,3-8H2,1-2H3 |
| InChIKey | VPVNSKZURJNVIX-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 5-isocyanatononane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-isocyanatononane?
The IUPAC name of 5-isocyanatononane (CID 153403979) is 5-isocyanatononane.
What is the SMILES notation for 5-isocyanatononane?
The canonical SMILES for 5-isocyanatononane is CCCCC(CCCC)N=C=O.
What is the InChIKey of 5-isocyanatononane?
The InChIKey is VPVNSKZURJNVIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO/c1-3-5-7-10(11-9-12)8-6-4-2/h10H,3-8H2,1-2H3.
What are the key properties of 5-isocyanatononane?
5-isocyanatononane has a molecular weight of 169.27 g/mol, XLogP of 3.07, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-isocyanatononane is sourced from PubChem (CID 153403979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).