C16H22N4O4 — CID 150641098
1,1,1,7-tetraisocyanatododecane (PubChem CID 150641098) has the molecular formula C16H22N4O4 and a molecular weight of 334.38 g/mol. Its IUPAC name is 1,1,1,7-tetraisocyanatododecane.
| Compound Name | 1,1,1,7-tetraisocyanatododecane |
|---|---|
| PubChem CID | 150641098 |
| Molecular Formula | C16H22N4O4 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 1,1,1,7-tetraisocyanatododecane |
| SMILES | CCCCCC(CCCCCC(N=C=O)(N=C=O)N=C=O)N=C=O |
| InChI | InChI=1S/C16H22N4O4/c1-2-3-5-8-15(17-11-21)9-6-4-7-10-16(18-12-22,19-13-23)20-14-24/h15H,2-10H2,1H3 |
| InChIKey | IZXQHIYLPKUDSM-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 117.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|