About 6,6-diisocyanatoundecane
6,6-diisocyanatoundecane (PubChem CID 161043518) has the molecular formula C13H22N2O2
and a molecular weight of 238.33 g/mol. Its IUPAC name is 6,6-diisocyanatoundecane.
Molecular Properties
| Compound Name | 6,6-diisocyanatoundecane |
| PubChem CID | 161043518 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 6,6-diisocyanatoundecane |
| SMILES | CCCCCC(CCCCC)(N=C=O)N=C=O |
| InChI | InChI=1S/C13H22N2O2/c1-3-5-7-9-13(14-11-16,15-12-17)10-8-6-4-2/h3-10H2,1-2H3 |
| InChIKey | UBEQOUWSVOOWPD-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 6,6-diisocyanatoundecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-diisocyanatoundecane?
The IUPAC name of 6,6-diisocyanatoundecane (CID 161043518) is 6,6-diisocyanatoundecane.
What is the SMILES notation for 6,6-diisocyanatoundecane?
The canonical SMILES for 6,6-diisocyanatoundecane is CCCCCC(CCCCC)(N=C=O)N=C=O.
What is the InChIKey of 6,6-diisocyanatoundecane?
The InChIKey is UBEQOUWSVOOWPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2O2/c1-3-5-7-9-13(14-11-16,15-12-17)10-8-6-4-2/h3-10H2,1-2H3.
What are the key properties of 6,6-diisocyanatoundecane?
6,6-diisocyanatoundecane has a molecular weight of 238.33 g/mol, XLogP of 3.51, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-diisocyanatoundecane is sourced from PubChem (CID 161043518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).