About 5-butyl-1,5-diisocyanatononane
5-butyl-1,5-diisocyanatononane (PubChem CID 87324424) has the molecular formula C15H26N2O2
and a molecular weight of 266.38 g/mol. Its IUPAC name is 5-butyl-1,5-diisocyanatononane.
Molecular Properties
| Compound Name | 5-butyl-1,5-diisocyanatononane |
| PubChem CID | 87324424 |
| Molecular Formula | C15H26N2O2 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | 5-butyl-1,5-diisocyanatononane |
| SMILES | CCCCC(CCCC)(CCCCN=C=O)N=C=O |
| InChI | InChI=1S/C15H26N2O2/c1-3-5-9-15(17-14-19,10-6-4-2)11-7-8-12-16-13-18/h3-12H2,1-2H3 |
| InChIKey | ONNFMUCTOYDTOG-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 5-butyl-1,5-diisocyanatononane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butyl-1,5-diisocyanatononane?
The IUPAC name of 5-butyl-1,5-diisocyanatononane (CID 87324424) is 5-butyl-1,5-diisocyanatononane.
What is the SMILES notation for 5-butyl-1,5-diisocyanatononane?
The canonical SMILES for 5-butyl-1,5-diisocyanatononane is CCCCC(CCCC)(CCCCN=C=O)N=C=O.
What is the InChIKey of 5-butyl-1,5-diisocyanatononane?
The InChIKey is ONNFMUCTOYDTOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26N2O2/c1-3-5-9-15(17-14-19,10-6-4-2)11-7-8-12-16-13-18/h3-12H2,1-2H3.
What are the key properties of 5-butyl-1,5-diisocyanatononane?
5-butyl-1,5-diisocyanatononane has a molecular weight of 266.38 g/mol, XLogP of 3.95, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butyl-1,5-diisocyanatononane is sourced from PubChem (CID 87324424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).