C12H18N2O4 — CID 88773929
2-butyl-2,6-diisocyanatohexanoic acid (PubChem CID 88773929) has the molecular formula C12H18N2O4 and a molecular weight of 254.29 g/mol. Its IUPAC name is 2-butyl-2,6-diisocyanatohexanoic acid.
| Compound Name | 2-butyl-2,6-diisocyanatohexanoic acid |
|---|---|
| PubChem CID | 88773929 |
| Molecular Formula | C12H18N2O4 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 2-butyl-2,6-diisocyanatohexanoic acid |
| SMILES | CCCCC(CCCCN=C=O)(N=C=O)C(=O)O |
| InChI | InChI=1S/C12H18N2O4/c1-2-3-6-12(11(17)18,14-10-16)7-4-5-8-13-9-15/h2-8H2,1H3,(H,17,18) |
| InChIKey | GXWFXBIWAARXIR-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 96.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|