About 1-isocyanatodecane-3,6-dione
1-isocyanatodecane-3,6-dione (PubChem CID 88718950) has the molecular formula C11H17NO3
and a molecular weight of 211.26 g/mol. Its IUPAC name is 1-isocyanatodecane-3,6-dione.
Molecular Properties
| Compound Name | 1-isocyanatodecane-3,6-dione |
| PubChem CID | 88718950 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 1-isocyanatodecane-3,6-dione |
| SMILES | CCCCC(=O)CCC(=O)CCN=C=O |
| InChI | InChI=1S/C11H17NO3/c1-2-3-4-10(14)5-6-11(15)7-8-12-9-13/h2-8H2,1H3 |
| InChIKey | HRIMCOCLHBRJEB-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 63.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 1-isocyanatodecane-3,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-isocyanatodecane-3,6-dione?
The IUPAC name of 1-isocyanatodecane-3,6-dione (CID 88718950) is 1-isocyanatodecane-3,6-dione.
What is the SMILES notation for 1-isocyanatodecane-3,6-dione?
The canonical SMILES for 1-isocyanatodecane-3,6-dione is CCCCC(=O)CCC(=O)CCN=C=O.
What is the InChIKey of 1-isocyanatodecane-3,6-dione?
The InChIKey is HRIMCOCLHBRJEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO3/c1-2-3-4-10(14)5-6-11(15)7-8-12-9-13/h2-8H2,1H3.
What are the key properties of 1-isocyanatodecane-3,6-dione?
1-isocyanatodecane-3,6-dione has a molecular weight of 211.26 g/mol, XLogP of 1.82, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-isocyanatodecane-3,6-dione is sourced from PubChem (CID 88718950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).