About 4-isocyanatobutanethioic S-acid
4-isocyanatobutanethioic S-acid (PubChem CID 152506612) has the molecular formula C5H7NO2S
and a molecular weight of 145.18 g/mol. Its IUPAC name is 4-isocyanatobutanethioic S-acid.
Molecular Properties
| Compound Name | 4-isocyanatobutanethioic S-acid |
| PubChem CID | 152506612 |
| Molecular Formula | C5H7NO2S |
| Molecular Weight | 145.18 g/mol |
| Exact Mass | 145.02 |
| IUPAC Name | 4-isocyanatobutanethioic S-acid |
| SMILES | O=C=NCCCC(=O)S |
| InChI | InChI=1S/C5H7NO2S/c7-4-6-3-1-2-5(8)9/h1-3H2,(H,8,9) |
| InChIKey | YEPJCQFTZKFMNH-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.18 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-isocyanatobutanethioic S-acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-isocyanatobutanethioic S-acid?
The IUPAC name of 4-isocyanatobutanethioic S-acid (CID 152506612) is 4-isocyanatobutanethioic S-acid.
What is the SMILES notation for 4-isocyanatobutanethioic S-acid?
The canonical SMILES for 4-isocyanatobutanethioic S-acid is O=C=NCCCC(=O)S.
What is the InChIKey of 4-isocyanatobutanethioic S-acid?
The InChIKey is YEPJCQFTZKFMNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7NO2S/c7-4-6-3-1-2-5(8)9/h1-3H2,(H,8,9).
What are the key properties of 4-isocyanatobutanethioic S-acid?
4-isocyanatobutanethioic S-acid has a molecular weight of 145.18 g/mol, XLogP of 0.56, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-isocyanatobutanethioic S-acid is sourced from PubChem (CID 152506612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).