C10H15F4NO — CID 159006949
3,3,4,4-tetrafluoro-1-isocyanatononane (PubChem CID 159006949) has the molecular formula C10H15F4NO and a molecular weight of 241.23 g/mol. Its IUPAC name is 3,3,4,4-tetrafluoro-1-isocyanatononane.
| Compound Name | 3,3,4,4-tetrafluoro-1-isocyanatononane |
|---|---|
| PubChem CID | 159006949 |
| Molecular Formula | C10H15F4NO |
| Molecular Weight | 241.23 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 3,3,4,4-tetrafluoro-1-isocyanatononane |
| SMILES | CCCCCC(F)(F)C(F)(F)CCN=C=O |
| InChI | InChI=1S/C10H15F4NO/c1-2-3-4-5-9(11,12)10(13,14)6-7-15-8-16/h2-7H2,1H3 |
| InChIKey | LUTODQDDMOZEIT-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.23 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|