About 1-isocyanatopentane;1-(trifluoromethyl)pyrazole
1-isocyanatopentane;1-(trifluoromethyl)pyrazole (PubChem CID 174859892) has the molecular formula C10H14F3N3O
and a molecular weight of 249.24 g/mol. Its IUPAC name is 1-isocyanatopentane;1-(trifluoromethyl)pyrazole.
Molecular Properties
| Compound Name | 1-isocyanatopentane;1-(trifluoromethyl)pyrazole |
| PubChem CID | 174859892 |
| Molecular Formula | C10H14F3N3O |
| Molecular Weight | 249.24 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | 1-isocyanatopentane;1-(trifluoromethyl)pyrazole |
| SMILES | CCCCCN=C=O.FC(F)(F)n1cccn1 |
| InChI | InChI=1S/C6H11NO.C4H3F3N2/c1-2-3-4-5-7-6-8;5-4(6,7)9-3-1-2-8-9/h2-5H2,1H3;1-3H |
| InChIKey | ADKBADSVAOGTAV-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.24 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 1-isocyanatopentane;1-(trifluoromethyl)pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-isocyanatopentane;1-(trifluoromethyl)pyrazole?
The IUPAC name of 1-isocyanatopentane;1-(trifluoromethyl)pyrazole (CID 174859892) is 1-isocyanatopentane;1-(trifluoromethyl)pyrazole.
What is the SMILES notation for 1-isocyanatopentane;1-(trifluoromethyl)pyrazole?
The canonical SMILES for 1-isocyanatopentane;1-(trifluoromethyl)pyrazole is CCCCCN=C=O.FC(F)(F)n1cccn1.
What is the InChIKey of 1-isocyanatopentane;1-(trifluoromethyl)pyrazole?
The InChIKey is ADKBADSVAOGTAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO.C4H3F3N2/c1-2-3-4-5-7-6-8;5-4(6,7)9-3-1-2-8-9/h2-5H2,1H3;1-3H.
What are the key properties of 1-isocyanatopentane;1-(trifluoromethyl)pyrazole?
1-isocyanatopentane;1-(trifluoromethyl)pyrazole has a molecular weight of 249.24 g/mol, XLogP of 2.87, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-isocyanatopentane;1-(trifluoromethyl)pyrazole is sourced from PubChem (CID 174859892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).