C28H48N2O6 — CID 88505774
2,8-diisocyanato-2,9-bis(6-methylheptyl)decanedioic acid (PubChem CID 88505774) has the molecular formula C28H48N2O6 and a molecular weight of 508.70 g/mol. Its IUPAC name is 2,8-diisocyanato-2,9-bis(6-methylheptyl)decanedioic acid.
| Compound Name | 2,8-diisocyanato-2,9-bis(6-methylheptyl)decanedioic acid |
|---|---|
| PubChem CID | 88505774 |
| Molecular Formula | C28H48N2O6 |
| Molecular Weight | 508.70 g/mol |
| Exact Mass | 508.35 |
| IUPAC Name | 2,8-diisocyanato-2,9-bis(6-methylheptyl)decanedioic acid |
| SMILES | CC(C)CCCCCC(C(=O)O)C(CCCCCC(CCCCCC(C)C)(N=C=O)C(=O)O)N=C=O |
| InChI | InChI=1S/C28H48N2O6/c1-22(2)14-8-5-10-16-24(26(33)34)25(29-20-31)17-11-7-13-19-28(27(35)36,30-21-32)18-12-6-9-15-23(3)4/h22-25H,5-19H2,1-4H3,(H,33,34)(H,35,36) |
| InChIKey | RXHKNEODIRUNOD-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 133.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.70 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|