C12H15N3O5 — CID 87730904
2,2,6-triisocyanato-3-propylhexanoic acid (PubChem CID 87730904) has the molecular formula C12H15N3O5 and a molecular weight of 281.27 g/mol. Its IUPAC name is 2,2,6-triisocyanato-3-propylhexanoic acid.
| Compound Name | 2,2,6-triisocyanato-3-propylhexanoic acid |
|---|---|
| PubChem CID | 87730904 |
| Molecular Formula | C12H15N3O5 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 2,2,6-triisocyanato-3-propylhexanoic acid |
| SMILES | CCCC(CCCN=C=O)C(N=C=O)(N=C=O)C(=O)O |
| InChI | InChI=1S/C12H15N3O5/c1-2-4-10(5-3-6-13-7-16)12(11(19)20,14-8-17)15-9-18/h10H,2-6H2,1H3,(H,19,20) |
| InChIKey | DULYHJUOZHDTIQ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 125.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|