C14H24N2O2 — CID 23454384
5,6-diethyl-1,6-diisocyanatooctane (PubChem CID 23454384) has the molecular formula C14H24N2O2 and a molecular weight of 252.36 g/mol. Its IUPAC name is 5,6-diethyl-1,6-diisocyanatooctane.
| Compound Name | 5,6-diethyl-1,6-diisocyanatooctane |
|---|---|
| PubChem CID | 23454384 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | 5,6-diethyl-1,6-diisocyanatooctane |
| SMILES | CCC(CCCCN=C=O)C(CC)(CC)N=C=O |
| InChI | InChI=1S/C14H24N2O2/c1-4-13(9-7-8-10-15-11-17)14(5-2,6-3)16-12-18/h13H,4-10H2,1-3H3 |
| InChIKey | DKBFTLGGSGOPAC-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|