C13H22N2O2 — CID 89251457
1,8-diisocyanato-7,8-dimethylnonane (PubChem CID 89251457) has the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. Its IUPAC name is 1,8-diisocyanato-7,8-dimethylnonane.
| Compound Name | 1,8-diisocyanato-7,8-dimethylnonane |
|---|---|
| PubChem CID | 89251457 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 1,8-diisocyanato-7,8-dimethylnonane |
| SMILES | CC(CCCCCCN=C=O)C(C)(C)N=C=O |
| InChI | InChI=1S/C13H22N2O2/c1-12(13(2,3)15-11-17)8-6-4-5-7-9-14-10-16/h12H,4-9H2,1-3H3 |
| InChIKey | NIZGZNGEXUDNLS-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|