C18H26N4O10 — CID 141233666
2,2,11,11-tetraisocyanato-3,10-dimethyldodecane-1,1,1,12,12,12-hexol (PubChem CID 141233666) has the molecular formula C18H26N4O10 and a molecular weight of 458.42 g/mol. Its IUPAC name is 2,2,11,11-tetraisocyanato-3,10-dimethyldodecane-1,1,1,12,12,12-hexol.
| Compound Name | 2,2,11,11-tetraisocyanato-3,10-dimethyldodecane-1,1,1,12,12,12-hexol |
|---|---|
| PubChem CID | 141233666 |
| Molecular Formula | C18H26N4O10 |
| Molecular Weight | 458.42 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | 2,2,11,11-tetraisocyanato-3,10-dimethyldodecane-1,1,1,12,12,12-hexol |
| SMILES | CC(CCCCCCC(C)C(N=C=O)(N=C=O)C(O)(O)O)C(N=C=O)(N=C=O)C(O)(O)O |
| InChI | InChI=1S/C18H26N4O10/c1-13(15(19-9-23,20-10-24)17(27,28)29)7-5-3-4-6-8-14(2)16(21-11-25,22-12-26)18(30,31)32/h13-14,27-32H,3-8H2,1-2H3 |
| InChIKey | CBEZWIYYMOGTFG-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 239.10 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.42 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|