C11H18N2O4 — CID 140977146
1,1-diisocyanato-2,4,4-trimethylhexane-1,6-diol (PubChem CID 140977146) has the molecular formula C11H18N2O4 and a molecular weight of 242.27 g/mol. Its IUPAC name is 1,1-diisocyanato-2,4,4-trimethylhexane-1,6-diol.
| Compound Name | 1,1-diisocyanato-2,4,4-trimethylhexane-1,6-diol |
|---|---|
| PubChem CID | 140977146 |
| Molecular Formula | C11H18N2O4 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 1,1-diisocyanato-2,4,4-trimethylhexane-1,6-diol |
| SMILES | CC(CC(C)(C)CCO)C(O)(N=C=O)N=C=O |
| InChI | InChI=1S/C11H18N2O4/c1-9(6-10(2,3)4-5-14)11(17,12-7-15)13-8-16/h9,14,17H,4-6H2,1-3H3 |
| InChIKey | SNHGFJUABYRBTK-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 99.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|