2-[(4-hydroxy-2,2-dimethylbutyl)amino]-3-methylbutanoic acid

C11H23NO3 — CID 106149098

IUPAC2-[(4-hydroxy-2,2-dimethylbutyl)amino]-3-methylbutanoic acid
SMILESCC(C)C(NCC(C)(C)CCO)C(=O)O
InChIInChI=1S/C11H23NO3/c1-8(2)9(10(14)15)12-7-11(3,4)5-6-13/h8-9,12-13H,5-7H2,1-4H3,(H,14,15)
InChIKeyNALDRGVYLFXEBE-UHFFFAOYSA-N
MW217.31 g/mol
LogP1.09
Rot. Bonds7

About 2-[(4-hydroxy-2,2-dimethylbutyl)amino]-3-methylbutanoic acid

2-[(4-hydroxy-2,2-dimethylbutyl)amino]-3-methylbutanoic acid (PubChem CID 106149098) has the molecular formula C11H23NO3 and a molecular weight of 217.31 g/mol. Its IUPAC name is 2-[(4-hydroxy-2,2-dimethylbutyl)amino]-3-methylbutanoic acid.

Molecular Properties

Compound Name2-[(4-hydroxy-2,2-dimethylbutyl)amino]-3-methylbutanoic acid
PubChem CID106149098
Molecular FormulaC11H23NO3
Molecular Weight217.31 g/mol
Exact Mass217.17
IUPAC Name2-[(4-hydroxy-2,2-dimethylbutyl)amino]-3-methylbutanoic acid
SMILESCC(C)C(NCC(C)(C)CCO)C(=O)O
InChIInChI=1S/C11H23NO3/c1-8(2)9(10(14)15)12-7-11(3,4)5-6-13/h8-9,12-13H,5-7H2,1-4H3,(H,14,15)
InChIKeyNALDRGVYLFXEBE-UHFFFAOYSA-N
XLogP1.09
TPSA69.56 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500217.31
LogP ≤ 51.09
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 2-[(4-hydroxy-2,2-dimethylbutyl)amino]-3-methylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(4-hydroxy-2,2-dimethylbutyl)amino]-3-methylbutanoic acid?
The IUPAC name of 2-[(4-hydroxy-2,2-dimethylbutyl)amino]-3-methylbutanoic acid (CID 106149098) is 2-[(4-hydroxy-2,2-dimethylbutyl)amino]-3-methylbutanoic acid.
What is the SMILES notation for 2-[(4-hydroxy-2,2-dimethylbutyl)amino]-3-methylbutanoic acid?
The canonical SMILES for 2-[(4-hydroxy-2,2-dimethylbutyl)amino]-3-methylbutanoic acid is CC(C)C(NCC(C)(C)CCO)C(=O)O.
What is the InChIKey of 2-[(4-hydroxy-2,2-dimethylbutyl)amino]-3-methylbutanoic acid?
The InChIKey is NALDRGVYLFXEBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO3/c1-8(2)9(10(14)15)12-7-11(3,4)5-6-13/h8-9,12-13H,5-7H2,1-4H3,(H,14,15).
What are the key properties of 2-[(4-hydroxy-2,2-dimethylbutyl)amino]-3-methylbutanoic acid?
2-[(4-hydroxy-2,2-dimethylbutyl)amino]-3-methylbutanoic acid has a molecular weight of 217.31 g/mol, XLogP of 1.09, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-hydroxy-2,2-dimethylbutyl)amino]-3-methylbutanoic acid is sourced from PubChem (CID 106149098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).