C8H17NO3 — CID 58703522
(2S)-2-[[(2R)-2-hydroxypropyl]amino]-3-methylbutanoic acid (PubChem CID 58703522) has the molecular formula C8H17NO3 and a molecular weight of 175.23 g/mol. Its IUPAC name is (2S)-2-[[(2R)-2-hydroxypropyl]amino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[[(2R)-2-hydroxypropyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 58703522 |
| Molecular Formula | C8H17NO3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.12 |
| IUPAC Name | (2S)-2-[[(2R)-2-hydroxypropyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@H](NC[C@@H](C)O)C(=O)O |
| InChI | InChI=1S/C8H17NO3/c1-5(2)7(8(11)12)9-4-6(3)10/h5-7,9-10H,4H2,1-3H3,(H,11,12)/t6-,7+/m1/s1 |
| InChIKey | LQFKABMWUHITQU-RQJHMYQMSA-N |
| XLogP | 0.07 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |