C8H16ClNO3 — CID 156963523
2-[(3-chloro-2-hydroxypropyl)amino]-3-methylbutanoic acid (PubChem CID 156963523) has the molecular formula C8H16ClNO3 and a molecular weight of 209.67 g/mol. Its IUPAC name is 2-[(3-chloro-2-hydroxypropyl)amino]-3-methylbutanoic acid.
| Compound Name | 2-[(3-chloro-2-hydroxypropyl)amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 156963523 |
| Molecular Formula | C8H16ClNO3 |
| Molecular Weight | 209.67 g/mol |
| Exact Mass | 209.08 |
| IUPAC Name | 2-[(3-chloro-2-hydroxypropyl)amino]-3-methylbutanoic acid |
| SMILES | CC(C)C(NCC(O)CCl)C(=O)O |
| InChI | InChI=1S/C8H16ClNO3/c1-5(2)7(8(12)13)10-4-6(11)3-9/h5-7,10-11H,3-4H2,1-2H3,(H,12,13) |
| InChIKey | ROURNSDBRYKIAJ-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.67 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|