C8H19N3O2 — CID 59819419
(2S)-2-[[(2S)-2,3-diaminopropyl]amino]-3-methylbutanoic acid (PubChem CID 59819419) has the molecular formula C8H19N3O2 and a molecular weight of 189.26 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2,3-diaminopropyl]amino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[[(2S)-2,3-diaminopropyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 59819419 |
| Molecular Formula | C8H19N3O2 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | (2S)-2-[[(2S)-2,3-diaminopropyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@H](NC[C@@H](N)CN)C(=O)O |
| InChI | InChI=1S/C8H19N3O2/c1-5(2)7(8(12)13)11-4-6(10)3-9/h5-7,11H,3-4,9-10H2,1-2H3,(H,12,13)/t6-,7-/m0/s1 |
| InChIKey | HHCHBNLHGDNTCO-BQBZGAKWSA-N |
| XLogP | -1.03 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |