C13H27NO2 — CID 122124273
(2R)-3-methyl-2-[(3-methyl-2-propan-2-ylbutyl)amino]butanoic acid (PubChem CID 122124273) has the molecular formula C13H27NO2 and a molecular weight of 229.36 g/mol. Its IUPAC name is (2R)-3-methyl-2-[(3-methyl-2-propan-2-ylbutyl)amino]butanoic acid.
| Compound Name | (2R)-3-methyl-2-[(3-methyl-2-propan-2-ylbutyl)amino]butanoic acid |
|---|---|
| PubChem CID | 122124273 |
| Molecular Formula | C13H27NO2 |
| Molecular Weight | 229.36 g/mol |
| Exact Mass | 229.20 |
| IUPAC Name | (2R)-3-methyl-2-[(3-methyl-2-propan-2-ylbutyl)amino]butanoic acid |
| SMILES | CC(C)C(CN[C@@H](C(=O)O)C(C)C)C(C)C |
| InChI | InChI=1S/C13H27NO2/c1-8(2)11(9(3)4)7-14-12(10(5)6)13(15)16/h8-12,14H,7H2,1-6H3,(H,15,16)/t12-/m1/s1 |
| InChIKey | OKULMHUKCRQSFB-GFCCVEGCSA-N |
| XLogP | 2.61 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.36 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |