C8H17NO4 — CID 54486502
(2S)-2-(2,3-dihydroxypropylamino)-3-methylbutanoic acid (PubChem CID 54486502) has the molecular formula C8H17NO4 and a molecular weight of 191.23 g/mol. Its IUPAC name is (2S)-2-(2,3-dihydroxypropylamino)-3-methylbutanoic acid.
| Compound Name | (2S)-2-(2,3-dihydroxypropylamino)-3-methylbutanoic acid |
|---|---|
| PubChem CID | 54486502 |
| Molecular Formula | C8H17NO4 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.12 |
| IUPAC Name | (2S)-2-(2,3-dihydroxypropylamino)-3-methylbutanoic acid |
| SMILES | CC(C)[C@H](NCC(O)CO)C(=O)O |
| InChI | InChI=1S/C8H17NO4/c1-5(2)7(8(12)13)9-3-6(11)4-10/h5-7,9-11H,3-4H2,1-2H3,(H,12,13)/t6?,7-/m0/s1 |
| InChIKey | XSRKHYQASYXTMX-MLWJPKLSSA-N |
| XLogP | -0.96 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |