C7H17NO2 — CID 61149708
(2S)-3-(butan-2-ylamino)propane-1,2-diol (PubChem CID 61149708) has the molecular formula C7H17NO2 and a molecular weight of 147.22 g/mol. Its IUPAC name is (2S)-3-(butan-2-ylamino)propane-1,2-diol.
| Compound Name | (2S)-3-(butan-2-ylamino)propane-1,2-diol |
|---|---|
| PubChem CID | 61149708 |
| Molecular Formula | C7H17NO2 |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.13 |
| IUPAC Name | (2S)-3-(butan-2-ylamino)propane-1,2-diol |
| SMILES | CCC(C)NC[C@H](O)CO |
| InChI | InChI=1S/C7H17NO2/c1-3-6(2)8-4-7(10)5-9/h6-10H,3-5H2,1-2H3/t6?,7-/m0/s1 |
| InChIKey | OQFTXPNFGZJZTP-MLWJPKLSSA-N |
| XLogP | -0.27 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |