C13H31N3O4 — CID 19347617
3-[1-[1-(2,3-dihydroxypropylamino)propyl-methylamino]propylamino]propane-1,2-diol (PubChem CID 19347617) has the molecular formula C13H31N3O4 and a molecular weight of 293.41 g/mol. Its IUPAC name is 3-[1-[1-(2,3-dihydroxypropylamino)propyl-methylamino]propylamino]propane-1,2-diol.
| Compound Name | 3-[1-[1-(2,3-dihydroxypropylamino)propyl-methylamino]propylamino]propane-1,2-diol |
|---|---|
| PubChem CID | 19347617 |
| Molecular Formula | C13H31N3O4 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.23 |
| IUPAC Name | 3-[1-[1-(2,3-dihydroxypropylamino)propyl-methylamino]propylamino]propane-1,2-diol |
| SMILES | CCC(NCC(O)CO)N(C)C(CC)NCC(O)CO |
| InChI | InChI=1S/C13H31N3O4/c1-4-12(14-6-10(19)8-17)16(3)13(5-2)15-7-11(20)9-18/h10-15,17-20H,4-9H2,1-3H3 |
| InChIKey | SQTDNBZMEIIYGZ-UHFFFAOYSA-N |
| XLogP | -1.72 |
| TPSA | 108.22 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|