C7H17NO3 — CID 156656657
(2R)-3-(1-hydroxybutylamino)propane-1,2-diol (PubChem CID 156656657) has the molecular formula C7H17NO3 and a molecular weight of 163.22 g/mol. Its IUPAC name is (2R)-3-(1-hydroxybutylamino)propane-1,2-diol.
| Compound Name | (2R)-3-(1-hydroxybutylamino)propane-1,2-diol |
|---|---|
| PubChem CID | 156656657 |
| Molecular Formula | C7H17NO3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.12 |
| IUPAC Name | (2R)-3-(1-hydroxybutylamino)propane-1,2-diol |
| SMILES | CCCC(O)NC[C@@H](O)CO |
| InChI | InChI=1S/C7H17NO3/c1-2-3-7(11)8-4-6(10)5-9/h6-11H,2-5H2,1H3/t6-,7?/m1/s1 |
| InChIKey | HGUZVLVOOVSXFL-ULUSZKPHSA-N |
| XLogP | -0.95 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|