C9H21NO3 — CID 77035883
3-(1-methoxypentan-2-ylamino)propane-1,2-diol (PubChem CID 77035883) has the molecular formula C9H21NO3 and a molecular weight of 191.27 g/mol. Its IUPAC name is 3-(1-methoxypentan-2-ylamino)propane-1,2-diol.
| Compound Name | 3-(1-methoxypentan-2-ylamino)propane-1,2-diol |
|---|---|
| PubChem CID | 77035883 |
| Molecular Formula | C9H21NO3 |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.15 |
| IUPAC Name | 3-(1-methoxypentan-2-ylamino)propane-1,2-diol |
| SMILES | CCCC(COC)NCC(O)CO |
| InChI | InChI=1S/C9H21NO3/c1-3-4-8(7-13-2)10-5-9(12)6-11/h8-12H,3-7H2,1-2H3 |
| InChIKey | NCXKXBWMILWBOB-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |