C9H21NO2 — CID 66177145
3-(2-methylpentan-3-ylamino)propane-1,2-diol (PubChem CID 66177145) has the molecular formula C9H21NO2 and a molecular weight of 175.27 g/mol. Its IUPAC name is 3-(2-methylpentan-3-ylamino)propane-1,2-diol.
| Compound Name | 3-(2-methylpentan-3-ylamino)propane-1,2-diol |
|---|---|
| PubChem CID | 66177145 |
| Molecular Formula | C9H21NO2 |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.16 |
| IUPAC Name | 3-(2-methylpentan-3-ylamino)propane-1,2-diol |
| SMILES | CCC(NCC(O)CO)C(C)C |
| InChI | InChI=1S/C9H21NO2/c1-4-9(7(2)3)10-5-8(12)6-11/h7-12H,4-6H2,1-3H3 |
| InChIKey | ZKEITVOUKQSKAQ-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |