C8H19NO2 — CID 58586490
3-(2-methylbutylamino)propane-1,2-diol (PubChem CID 58586490) has the molecular formula C8H19NO2 and a molecular weight of 161.25 g/mol. Its IUPAC name is 3-(2-methylbutylamino)propane-1,2-diol.
| Compound Name | 3-(2-methylbutylamino)propane-1,2-diol |
|---|---|
| PubChem CID | 58586490 |
| Molecular Formula | C8H19NO2 |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.14 |
| IUPAC Name | 3-(2-methylbutylamino)propane-1,2-diol |
| SMILES | CCC(C)CNCC(O)CO |
| InChI | InChI=1S/C8H19NO2/c1-3-7(2)4-9-5-8(11)6-10/h7-11H,3-6H2,1-2H3 |
| InChIKey | RFBDJQINPIFOLE-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |