C11H25N — CID 59084986
(2S)-2,3-dimethyl-N-(2-methylbutyl)butan-1-amine (PubChem CID 59084986) has the molecular formula C11H25N and a molecular weight of 171.33 g/mol. Its IUPAC name is (2S)-2,3-dimethyl-N-(2-methylbutyl)butan-1-amine.
| Compound Name | (2S)-2,3-dimethyl-N-(2-methylbutyl)butan-1-amine |
|---|---|
| PubChem CID | 59084986 |
| Molecular Formula | C11H25N |
| Molecular Weight | 171.33 g/mol |
| Exact Mass | 171.20 |
| IUPAC Name | (2S)-2,3-dimethyl-N-(2-methylbutyl)butan-1-amine |
| SMILES | CCC(C)CNC[C@@H](C)C(C)C |
| InChI | InChI=1S/C11H25N/c1-6-10(4)7-12-8-11(5)9(2)3/h9-12H,6-8H2,1-5H3/t10?,11-/m1/s1 |
| InChIKey | PQBXNLKHQMKPMK-RRKGBCIJSA-N |
| XLogP | 2.91 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.33 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |