C11H26N2O2 — CID 58586497
3-[[4-(aminomethyl)-2-methylhexyl]amino]propane-1,2-diol (PubChem CID 58586497) has the molecular formula C11H26N2O2 and a molecular weight of 218.34 g/mol. Its IUPAC name is 3-[[4-(aminomethyl)-2-methylhexyl]amino]propane-1,2-diol.
| Compound Name | 3-[[4-(aminomethyl)-2-methylhexyl]amino]propane-1,2-diol |
|---|---|
| PubChem CID | 58586497 |
| Molecular Formula | C11H26N2O2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.20 |
| IUPAC Name | 3-[[4-(aminomethyl)-2-methylhexyl]amino]propane-1,2-diol |
| SMILES | CCC(CN)CC(C)CNCC(O)CO |
| InChI | InChI=1S/C11H26N2O2/c1-3-10(5-12)4-9(2)6-13-7-11(15)8-14/h9-11,13-15H,3-8,12H2,1-2H3 |
| InChIKey | KAOOCIJNUHRWKV-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |