C20H46N4O4 — CID 91550799
[5-[[3-[[4-(aminomethyl)-2-methylhexyl]amino]-2-hydroxypropyl]amino]-2-ethyl-4-methylpentyl]azanium;oxido formate (PubChem CID 91550799) has the molecular formula C20H46N4O4 and a molecular weight of 406.61 g/mol. Its IUPAC name is [5-[[3-[[4-(aminomethyl)-2-methylhexyl]amino]-2-hydroxypropyl]amino]-2-ethyl-4-methylpentyl]azanium;oxido formate.
| Compound Name | [5-[[3-[[4-(aminomethyl)-2-methylhexyl]amino]-2-hydroxypropyl]amino]-2-ethyl-4-methylpentyl]azanium;oxido formate |
|---|---|
| PubChem CID | 91550799 |
| Molecular Formula | C20H46N4O4 |
| Molecular Weight | 406.61 g/mol |
| Exact Mass | 406.35 |
| IUPAC Name | [5-[[3-[[4-(aminomethyl)-2-methylhexyl]amino]-2-hydroxypropyl]amino]-2-ethyl-4-methylpentyl]azanium;oxido formate |
| SMILES | CCC(CN)CC(C)CNCC(O)CNCC(C)CC(CC)C[NH3+].O=CO[O-] |
| InChI | InChI=1S/C19H44N4O.CH2O3/c1-5-17(9-20)7-15(3)11-22-13-19(24)14-23-12-16(4)8-18(6-2)10-21;2-1-4-3/h15-19,22-24H,5-14,20-21H2,1-4H3;1,3H |
| InChIKey | XJZNZSLCSYYFOA-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 147.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.61 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|