C21H46N2O — CID 58325451
1,3-bis[(4-ethyl-2-methylhexyl)amino]propan-2-ol (PubChem CID 58325451) has the molecular formula C21H46N2O and a molecular weight of 342.61 g/mol. Its IUPAC name is 1,3-bis[(4-ethyl-2-methylhexyl)amino]propan-2-ol.
| Compound Name | 1,3-bis[(4-ethyl-2-methylhexyl)amino]propan-2-ol |
|---|---|
| PubChem CID | 58325451 |
| Molecular Formula | C21H46N2O |
| Molecular Weight | 342.61 g/mol |
| Exact Mass | 342.36 |
| IUPAC Name | 1,3-bis[(4-ethyl-2-methylhexyl)amino]propan-2-ol |
| SMILES | CCC(CC)CC(C)CNCC(O)CNCC(C)CC(CC)CC |
| InChI | InChI=1S/C21H46N2O/c1-7-19(8-2)11-17(5)13-22-15-21(24)16-23-14-18(6)12-20(9-3)10-4/h17-24H,7-16H2,1-6H3 |
| InChIKey | HWDVSCAYXIBMMJ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.61 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |