About butan-2-ol;1-(2-hydroxypropylamino)-4-methylpentan-2-ol
butan-2-ol;1-(2-hydroxypropylamino)-4-methylpentan-2-ol (PubChem CID 158990832) has the molecular formula C13H31NO3
and a molecular weight of 249.39 g/mol. Its IUPAC name is butan-2-ol;1-(2-hydroxypropylamino)-4-methylpentan-2-ol.
Molecular Properties
| Compound Name | butan-2-ol;1-(2-hydroxypropylamino)-4-methylpentan-2-ol |
| PubChem CID | 158990832 |
| Molecular Formula | C13H31NO3 |
| Molecular Weight | 249.39 g/mol |
| Exact Mass | 249.23 |
| IUPAC Name | butan-2-ol;1-(2-hydroxypropylamino)-4-methylpentan-2-ol |
| SMILES | CC(C)CC(O)CNCC(C)O.CCC(C)O |
| InChI | InChI=1S/C9H21NO2.C4H10O/c1-7(2)4-9(12)6-10-5-8(3)11;1-3-4(2)5/h7-12H,4-6H2,1-3H3;4-5H,3H2,1-2H3 |
| InChIKey | JQDIIPKPRMDKHU-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.39 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze butan-2-ol;1-(2-hydroxypropylamino)-4-methylpentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-ol;1-(2-hydroxypropylamino)-4-methylpentan-2-ol?
The IUPAC name of butan-2-ol;1-(2-hydroxypropylamino)-4-methylpentan-2-ol (CID 158990832) is butan-2-ol;1-(2-hydroxypropylamino)-4-methylpentan-2-ol.
What is the SMILES notation for butan-2-ol;1-(2-hydroxypropylamino)-4-methylpentan-2-ol?
The canonical SMILES for butan-2-ol;1-(2-hydroxypropylamino)-4-methylpentan-2-ol is CC(C)CC(O)CNCC(C)O.CCC(C)O.
What is the InChIKey of butan-2-ol;1-(2-hydroxypropylamino)-4-methylpentan-2-ol?
The InChIKey is JQDIIPKPRMDKHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21NO2.C4H10O/c1-7(2)4-9(12)6-10-5-8(3)11;1-3-4(2)5/h7-12H,4-6H2,1-3H3;4-5H,3H2,1-2H3.
What are the key properties of butan-2-ol;1-(2-hydroxypropylamino)-4-methylpentan-2-ol?
butan-2-ol;1-(2-hydroxypropylamino)-4-methylpentan-2-ol has a molecular weight of 249.39 g/mol, XLogP of 1.14, 7 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-ol;1-(2-hydroxypropylamino)-4-methylpentan-2-ol is sourced from PubChem (CID 158990832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).