About butan-2-ol;1-(methylamino)propan-2-ol
butan-2-ol;1-(methylamino)propan-2-ol (PubChem CID 143199215) has the molecular formula C8H21NO2
and a molecular weight of 163.26 g/mol. Its IUPAC name is butan-2-ol;1-(methylamino)propan-2-ol.
Molecular Properties
| Compound Name | butan-2-ol;1-(methylamino)propan-2-ol |
| PubChem CID | 143199215 |
| Molecular Formula | C8H21NO2 |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.16 |
| IUPAC Name | butan-2-ol;1-(methylamino)propan-2-ol |
| SMILES | CCC(C)O.CNCC(C)O |
| InChI | InChI=1S/C4H11NO.C4H10O/c1-4(6)3-5-2;1-3-4(2)5/h4-6H,3H2,1-2H3;4-5H,3H2,1-2H3 |
| InChIKey | MLGOAUMOCNCZTD-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze butan-2-ol;1-(methylamino)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-ol;1-(methylamino)propan-2-ol?
The IUPAC name of butan-2-ol;1-(methylamino)propan-2-ol (CID 143199215) is butan-2-ol;1-(methylamino)propan-2-ol.
What is the SMILES notation for butan-2-ol;1-(methylamino)propan-2-ol?
The canonical SMILES for butan-2-ol;1-(methylamino)propan-2-ol is CCC(C)O.CNCC(C)O.
What is the InChIKey of butan-2-ol;1-(methylamino)propan-2-ol?
The InChIKey is MLGOAUMOCNCZTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11NO.C4H10O/c1-4(6)3-5-2;1-3-4(2)5/h4-6H,3H2,1-2H3;4-5H,3H2,1-2H3.
What are the key properties of butan-2-ol;1-(methylamino)propan-2-ol?
butan-2-ol;1-(methylamino)propan-2-ol has a molecular weight of 163.26 g/mol, XLogP of 0.36, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-ol;1-(methylamino)propan-2-ol is sourced from PubChem (CID 143199215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).