About 1-aminopropan-1-ol;1-(methylamino)propan-2-ol
1-aminopropan-1-ol;1-(methylamino)propan-2-ol (PubChem CID 87558046) has the molecular formula C7H20N2O2
and a molecular weight of 164.25 g/mol. Its IUPAC name is 1-aminopropan-1-ol;1-(methylamino)propan-2-ol.
Molecular Properties
| Compound Name | 1-aminopropan-1-ol;1-(methylamino)propan-2-ol |
| PubChem CID | 87558046 |
| Molecular Formula | C7H20N2O2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.15 |
| IUPAC Name | 1-aminopropan-1-ol;1-(methylamino)propan-2-ol |
| SMILES | CCC(N)O.CNCC(C)O |
| InChI | InChI=1S/C4H11NO.C3H9NO/c1-4(6)3-5-2;1-2-3(4)5/h4-6H,3H2,1-2H3;3,5H,2,4H2,1H3 |
| InChIKey | NHTQDCJCSKZZPQ-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-aminopropan-1-ol;1-(methylamino)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminopropan-1-ol;1-(methylamino)propan-2-ol?
The IUPAC name of 1-aminopropan-1-ol;1-(methylamino)propan-2-ol (CID 87558046) is 1-aminopropan-1-ol;1-(methylamino)propan-2-ol.
What is the SMILES notation for 1-aminopropan-1-ol;1-(methylamino)propan-2-ol?
The canonical SMILES for 1-aminopropan-1-ol;1-(methylamino)propan-2-ol is CCC(N)O.CNCC(C)O.
What is the InChIKey of 1-aminopropan-1-ol;1-(methylamino)propan-2-ol?
The InChIKey is NHTQDCJCSKZZPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11NO.C3H9NO/c1-4(6)3-5-2;1-2-3(4)5/h4-6H,3H2,1-2H3;3,5H,2,4H2,1H3.
What are the key properties of 1-aminopropan-1-ol;1-(methylamino)propan-2-ol?
1-aminopropan-1-ol;1-(methylamino)propan-2-ol has a molecular weight of 164.25 g/mol, XLogP of -0.74, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminopropan-1-ol;1-(methylamino)propan-2-ol is sourced from PubChem (CID 87558046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).