About aluminum butan-2-ol
aluminum butan-2-ol (PubChem CID 23623700) has the molecular formula C4H10AlO+3
and a molecular weight of 101.11 g/mol. Its IUPAC name is aluminum butan-2-ol.
Molecular Properties
| Compound Name | aluminum butan-2-ol |
| PubChem CID | 23623700 |
| Molecular Formula | C4H10AlO+3 |
| Molecular Weight | 101.11 g/mol |
| Exact Mass | 101.05 |
| IUPAC Name | aluminum butan-2-ol |
| SMILES | CCC(C)O.[Al+3] |
| InChI | InChI=1S/C4H10O.Al/c1-3-4(2)5;/h4-5H,3H2,1-2H3;/q;+3 |
| InChIKey | UEGVYGKKZVJDDT-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 101.11 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze aluminum butan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aluminum butan-2-ol?
The IUPAC name of aluminum butan-2-ol (CID 23623700) is aluminum butan-2-ol.
What is the SMILES notation for aluminum butan-2-ol?
The canonical SMILES for aluminum butan-2-ol is CCC(C)O.[Al+3].
What is the InChIKey of aluminum butan-2-ol?
The InChIKey is UEGVYGKKZVJDDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O.Al/c1-3-4(2)5;/h4-5H,3H2,1-2H3;/q;+3.
What are the key properties of aluminum butan-2-ol?
aluminum butan-2-ol has a molecular weight of 101.11 g/mol, XLogP of 0.40, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for aluminum butan-2-ol is sourced from PubChem (CID 23623700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).