About butan-2-ol;but-2-ene
butan-2-ol;but-2-ene (PubChem CID 157060914) has the molecular formula C8H18O
and a molecular weight of 130.23 g/mol. Its IUPAC name is butan-2-ol;but-2-ene.
Molecular Properties
| Compound Name | butan-2-ol;but-2-ene |
| PubChem CID | 157060914 |
| Molecular Formula | C8H18O |
| Molecular Weight | 130.23 g/mol |
| Exact Mass | 130.14 |
| IUPAC Name | butan-2-ol;but-2-ene |
| SMILES | CC=CC.CCC(C)O |
| InChI | InChI=1S/C4H10O.C4H8/c1-3-4(2)5;1-3-4-2/h4-5H,3H2,1-2H3;3-4H,1-2H3 |
| InChIKey | ABIAHOHSSUREQM-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.23 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze butan-2-ol;but-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-ol;but-2-ene?
The IUPAC name of butan-2-ol;but-2-ene (CID 157060914) is butan-2-ol;but-2-ene.
What is the SMILES notation for butan-2-ol;but-2-ene?
The canonical SMILES for butan-2-ol;but-2-ene is CC=CC.CCC(C)O.
What is the InChIKey of butan-2-ol;but-2-ene?
The InChIKey is ABIAHOHSSUREQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O.C4H8/c1-3-4(2)5;1-3-4-2/h4-5H,3H2,1-2H3;3-4H,1-2H3.
What are the key properties of butan-2-ol;but-2-ene?
butan-2-ol;but-2-ene has a molecular weight of 130.23 g/mol, XLogP of 2.36, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-ol;but-2-ene is sourced from PubChem (CID 157060914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).