C47H109N11O — CID 142218265
1-[[4,8-bis(aminomethyl)-2-[2,4-bis(aminomethyl)hexyl]-6-methyldecyl]amino]butan-2-ol;4,6,8,10-tetrakis(aminomethyl)-2-ethyl-12-propyltridecane-1,13-diamine (PubChem CID 142218265) has the molecular formula C47H109N11O and a molecular weight of 844.46 g/mol. Its IUPAC name is 1-[[4,8-bis(aminomethyl)-2-[2,4-bis(aminomethyl)hexyl]-6-methyldecyl]amino]butan-2-ol;4,6,8,10-tetrakis(aminomethyl)-2-ethyl-12-propyltridecane-1,13-diamine.
| Compound Name | 1-[[4,8-bis(aminomethyl)-2-[2,4-bis(aminomethyl)hexyl]-6-methyldecyl]amino]butan-2-ol;4,6,8,10-tetrakis(aminomethyl)-2-ethyl-12-propyltridecane-1,13-diamine |
|---|---|
| PubChem CID | 142218265 |
| Molecular Formula | C47H109N11O |
| Molecular Weight | 844.46 g/mol |
| Exact Mass | 843.88 |
| IUPAC Name | 1-[[4,8-bis(aminomethyl)-2-[2,4-bis(aminomethyl)hexyl]-6-methyldecyl]amino]butan-2-ol;4,6,8,10-tetrakis(aminomethyl)-2-ethyl-12-propyltridecane-1,13-diamine |
| SMILES | CCC(O)CNCC(CC(CN)CC(C)CC(CC)CN)CC(CN)CC(CC)CN.CCCC(CN)CC(CN)CC(CN)CC(CN)CC(CN)CC(CC)CN |
| InChI | InChI=1S/C25H57N5O.C22H52N6/c1-5-20(13-26)8-19(4)9-22(15-28)11-24(17-30-18-25(31)7-3)12-23(16-29)10-21(6-2)14-27;1-3-5-18(12-24)7-20(14-26)9-22(16-28)10-21(15-27)8-19(13-25)6-17(4-2)11-23/h19-25,30-31H,5-18,26-29H2,1-4H3;17-22H,3-16,23-28H2,1-2H3 |
| InChIKey | WUZMKXSJOWTUSZ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 292.46 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 844.46 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 12 |