C14H31N — CID 82930255
4-ethyl-N,2-dipropylhexan-1-amine (PubChem CID 82930255) has the molecular formula C14H31N and a molecular weight of 213.41 g/mol. Its IUPAC name is 4-ethyl-N,2-dipropylhexan-1-amine.
| Compound Name | 4-ethyl-N,2-dipropylhexan-1-amine |
|---|---|
| PubChem CID | 82930255 |
| Molecular Formula | C14H31N |
| Molecular Weight | 213.41 g/mol |
| Exact Mass | 213.25 |
| IUPAC Name | 4-ethyl-N,2-dipropylhexan-1-amine |
| SMILES | CCCNCC(CCC)CC(CC)CC |
| InChI | InChI=1S/C14H31N/c1-5-9-14(12-15-10-6-2)11-13(7-3)8-4/h13-15H,5-12H2,1-4H3 |
| InChIKey | VLKKKMJACGJNSF-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.41 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|