About 5-methyl-N,2-dipropylhexan-1-amine
5-methyl-N,2-dipropylhexan-1-amine (PubChem CID 63497105) has the molecular formula C13H29N
and a molecular weight of 199.38 g/mol. Its IUPAC name is 5-methyl-N,2-dipropylhexan-1-amine.
Molecular Properties
| Compound Name | 5-methyl-N,2-dipropylhexan-1-amine |
| PubChem CID | 63497105 |
| Molecular Formula | C13H29N |
| Molecular Weight | 199.38 g/mol |
| Exact Mass | 199.23 |
| IUPAC Name | 5-methyl-N,2-dipropylhexan-1-amine |
| SMILES | CCCNCC(CCC)CCC(C)C |
| InChI | InChI=1S/C13H29N/c1-5-7-13(9-8-12(3)4)11-14-10-6-2/h12-14H,5-11H2,1-4H3 |
| InChIKey | ZLKBJCUBWDKIOT-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.38 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-N,2-dipropylhexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-N,2-dipropylhexan-1-amine?
The IUPAC name of 5-methyl-N,2-dipropylhexan-1-amine (CID 63497105) is 5-methyl-N,2-dipropylhexan-1-amine.
What is the SMILES notation for 5-methyl-N,2-dipropylhexan-1-amine?
The canonical SMILES for 5-methyl-N,2-dipropylhexan-1-amine is CCCNCC(CCC)CCC(C)C.
What is the InChIKey of 5-methyl-N,2-dipropylhexan-1-amine?
The InChIKey is ZLKBJCUBWDKIOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H29N/c1-5-7-13(9-8-12(3)4)11-14-10-6-2/h12-14H,5-11H2,1-4H3.
What are the key properties of 5-methyl-N,2-dipropylhexan-1-amine?
5-methyl-N,2-dipropylhexan-1-amine has a molecular weight of 199.38 g/mol, XLogP of 3.84, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-N,2-dipropylhexan-1-amine is sourced from PubChem (CID 63497105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).