About N-ethylpropan-1-amine;2-methylpentane
N-ethylpropan-1-amine;2-methylpentane (PubChem CID 171506483) has the molecular formula C11H27N
and a molecular weight of 173.34 g/mol. Its IUPAC name is N-ethylpropan-1-amine;2-methylpentane.
Molecular Properties
| Compound Name | N-ethylpropan-1-amine;2-methylpentane |
| PubChem CID | 171506483 |
| Molecular Formula | C11H27N |
| Molecular Weight | 173.34 g/mol |
| Exact Mass | 173.21 |
| IUPAC Name | N-ethylpropan-1-amine;2-methylpentane |
| SMILES | CCCC(C)C.CCCNCC |
| InChI | InChI=1S/C6H14.C5H13N/c1-4-5-6(2)3;1-3-5-6-4-2/h6H,4-5H2,1-3H3;6H,3-5H2,1-2H3 |
| InChIKey | KIUFYDDRUGXXSY-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.34 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-ethylpropan-1-amine;2-methylpentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethylpropan-1-amine;2-methylpentane?
The IUPAC name of N-ethylpropan-1-amine;2-methylpentane (CID 171506483) is N-ethylpropan-1-amine;2-methylpentane.
What is the SMILES notation for N-ethylpropan-1-amine;2-methylpentane?
The canonical SMILES for N-ethylpropan-1-amine;2-methylpentane is CCCC(C)C.CCCNCC.
What is the InChIKey of N-ethylpropan-1-amine;2-methylpentane?
The InChIKey is KIUFYDDRUGXXSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14.C5H13N/c1-4-5-6(2)3;1-3-5-6-4-2/h6H,4-5H2,1-3H3;6H,3-5H2,1-2H3.
What are the key properties of N-ethylpropan-1-amine;2-methylpentane?
N-ethylpropan-1-amine;2-methylpentane has a molecular weight of 173.34 g/mol, XLogP of 3.45, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethylpropan-1-amine;2-methylpentane is sourced from PubChem (CID 171506483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).