C11H26N2 — CID 163901497
N-ethyl-3-methyl-N'-propylpentane-1,5-diamine (PubChem CID 163901497) has the molecular formula C11H26N2 and a molecular weight of 186.34 g/mol. Its IUPAC name is N-ethyl-3-methyl-N'-propylpentane-1,5-diamine.
| Compound Name | N-ethyl-3-methyl-N'-propylpentane-1,5-diamine |
|---|---|
| PubChem CID | 163901497 |
| Molecular Formula | C11H26N2 |
| Molecular Weight | 186.34 g/mol |
| Exact Mass | 186.21 |
| IUPAC Name | N-ethyl-3-methyl-N'-propylpentane-1,5-diamine |
| SMILES | CCCNCCC(C)CCNCC |
| InChI | InChI=1S/C11H26N2/c1-4-8-13-10-7-11(3)6-9-12-5-2/h11-13H,4-10H2,1-3H3 |
| InChIKey | QKGKLTFNWPZBOZ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.34 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|