C31H70N4 — CID 21331399
N,N'-dibutyl-2,5-dimethylheptane-1,7-diamine;N,N'-diethyl-5-methylnonane-1,9-diamine (PubChem CID 21331399) has the molecular formula C31H70N4 and a molecular weight of 498.93 g/mol. Its IUPAC name is N,N'-dibutyl-2,5-dimethylheptane-1,7-diamine;N,N'-diethyl-5-methylnonane-1,9-diamine.
| Compound Name | N,N'-dibutyl-2,5-dimethylheptane-1,7-diamine;N,N'-diethyl-5-methylnonane-1,9-diamine |
|---|---|
| PubChem CID | 21331399 |
| Molecular Formula | C31H70N4 |
| Molecular Weight | 498.93 g/mol |
| Exact Mass | 498.56 |
| IUPAC Name | N,N'-dibutyl-2,5-dimethylheptane-1,7-diamine;N,N'-diethyl-5-methylnonane-1,9-diamine |
| SMILES | CCCCNCCC(C)CCC(C)CNCCCC.CCNCCCCC(C)CCCCNCC |
| InChI | InChI=1S/C17H38N2.C14H32N2/c1-5-7-12-18-14-11-16(3)9-10-17(4)15-19-13-8-6-2;1-4-15-12-8-6-10-14(3)11-7-9-13-16-5-2/h16-19H,5-15H2,1-4H3;14-16H,4-13H2,1-3H3 |
| InChIKey | DECBIWAGMYVQPE-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.93 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|