C10H26N2 — CID 142254763
N,N'-diethyl-2-methylpentane-1,5-diamine;molecular hydrogen (PubChem CID 142254763) has the molecular formula C10H26N2 and a molecular weight of 174.33 g/mol. Its IUPAC name is N,N'-diethyl-2-methylpentane-1,5-diamine;molecular hydrogen.
| Compound Name | N,N'-diethyl-2-methylpentane-1,5-diamine;molecular hydrogen |
|---|---|
| PubChem CID | 142254763 |
| Molecular Formula | C10H26N2 |
| Molecular Weight | 174.33 g/mol |
| Exact Mass | 174.21 |
| IUPAC Name | N,N'-diethyl-2-methylpentane-1,5-diamine;molecular hydrogen |
| SMILES | CCNCCCC(C)CNCC.[H][H] |
| InChI | InChI=1S/C10H24N2.H2/c1-4-11-8-6-7-10(3)9-12-5-2;/h10-12H,4-9H2,1-3H3;1H |
| InChIKey | TWUNYOMOTAHFLW-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.33 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|