C7H18N2 — CID 79001608
N-ethyl-2-methylbutane-1,4-diamine (PubChem CID 79001608) has the molecular formula C7H18N2 and a molecular weight of 130.23 g/mol. Its IUPAC name is N-ethyl-2-methylbutane-1,4-diamine.
| Compound Name | N-ethyl-2-methylbutane-1,4-diamine |
|---|---|
| PubChem CID | 79001608 |
| Molecular Formula | C7H18N2 |
| Molecular Weight | 130.23 g/mol |
| Exact Mass | 130.15 |
| IUPAC Name | N-ethyl-2-methylbutane-1,4-diamine |
| SMILES | CCNCC(C)CCN |
| InChI | InChI=1S/C7H18N2/c1-3-9-6-7(2)4-5-8/h7,9H,3-6,8H2,1-2H3 |
| InChIKey | QIDZHPRFAHERPX-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.23 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |